C14H21N3O2S — CID 142264915
[methyl-oxo-[4-(5-propyl-2-pyridinyl)piperazin-1-yl]-λ6-sulfanylidene]methanone (PubChem CID 142264915) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is [methyl-oxo-[4-(5-propyl-2-pyridinyl)piperazin-1-yl]-λ6-sulfanylidene]methanone.
| Compound Name | [methyl-oxo-[4-(5-propyl-2-pyridinyl)piperazin-1-yl]-λ6-sulfanylidene]methanone |
|---|---|
| PubChem CID | 142264915 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [methyl-oxo-[4-(5-propyl-2-pyridinyl)piperazin-1-yl]-λ6-sulfanylidene]methanone |
| SMILES | CCCc1ccc(N2CCN(S(C)(=O)=C=O)CC2)nc1 |
| InChI | InChI=1S/C14H21N3O2S/c1-3-4-13-5-6-14(15-11-13)16-7-9-17(10-8-16)20(2,19)12-18/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | QYYUEQYYIPFVEI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|