C18H31N5 — CID 155403164
1-ethyl-4-[5-[(4-ethylpiperazin-1-yl)methyl]-2-pyridinyl]piperazine (PubChem CID 155403164) has the molecular formula C18H31N5 and a molecular weight of 317.48 g/mol. Its IUPAC name is 1-ethyl-4-[5-[(4-ethylpiperazin-1-yl)methyl]-2-pyridinyl]piperazine.
| Compound Name | 1-ethyl-4-[5-[(4-ethylpiperazin-1-yl)methyl]-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 155403164 |
| Molecular Formula | C18H31N5 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 1-ethyl-4-[5-[(4-ethylpiperazin-1-yl)methyl]-2-pyridinyl]piperazine |
| SMILES | CCN1CCN(Cc2ccc(N3CCN(CC)CC3)nc2)CC1 |
| InChI | InChI=1S/C18H31N5/c1-3-20-7-9-22(10-8-20)16-17-5-6-18(19-15-17)23-13-11-21(4-2)12-14-23/h5-6,15H,3-4,7-14,16H2,1-2H3 |
| InChIKey | DIYGNDINCDXCGH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 25.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |