C14H24N4O4S2 — CID 24525934
N,N-diethyl-6-(4-methylsulfonylpiperazin-1-yl)pyridine-3-sulfonamide (PubChem CID 24525934) has the molecular formula C14H24N4O4S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N,N-diethyl-6-(4-methylsulfonylpiperazin-1-yl)pyridine-3-sulfonamide.
| Compound Name | N,N-diethyl-6-(4-methylsulfonylpiperazin-1-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 24525934 |
| Molecular Formula | C14H24N4O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N,N-diethyl-6-(4-methylsulfonylpiperazin-1-yl)pyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCN(S(C)(=O)=O)CC2)nc1 |
| InChI | InChI=1S/C14H24N4O4S2/c1-4-17(5-2)24(21,22)13-6-7-14(15-12-13)16-8-10-18(11-9-16)23(3,19)20/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | XXOYMOQRLNXVDD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |