C19H20ClF5N2O5S2 — CID 87956469
N-hydroxy-4-[5-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]thiophen-2-yl]sulfonyloxane-4-carboxamide;hydrochloride (PubChem CID 87956469) has the molecular formula C19H20ClF5N2O5S2 and a molecular weight of 550.96 g/mol. Its IUPAC name is N-hydroxy-4-[5-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]thiophen-2-yl]sulfonyloxane-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[5-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]thiophen-2-yl]sulfonyloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 87956469 |
| Molecular Formula | C19H20ClF5N2O5S2 |
| Molecular Weight | 550.96 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | N-hydroxy-4-[5-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]thiophen-2-yl]sulfonyloxane-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cn3)s2)CCOCC1 |
| InChI | InChI=1S/C19H19F5N2O5S2.ClH/c20-18(21,19(22,23)24)6-5-12-1-2-13(25-11-12)14-3-4-15(32-14)33(29,30)17(16(27)26-28)7-9-31-10-8-17;/h1-4,11,28H,5-10H2,(H,26,27);1H |
| InChIKey | TYDIJCBQJGOPKR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.96 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|