C27H32F6N4O6S — CID 158141356
1-benzyl-N-hydroxy-4-(4-phenylpiperazin-1-yl)sulfonylpiperidine-4-carboxamide;bis(2,2,2-trifluoroacetaldehyde) (PubChem CID 158141356) has the molecular formula C27H32F6N4O6S and a molecular weight of 654.63 g/mol. Its IUPAC name is 1-benzyl-N-hydroxy-4-(4-phenylpiperazin-1-yl)sulfonylpiperidine-4-carboxamide;bis(2,2,2-trifluoroacetaldehyde).
| Compound Name | 1-benzyl-N-hydroxy-4-(4-phenylpiperazin-1-yl)sulfonylpiperidine-4-carboxamide;bis(2,2,2-trifluoroacetaldehyde) |
|---|---|
| PubChem CID | 158141356 |
| Molecular Formula | C27H32F6N4O6S |
| Molecular Weight | 654.63 g/mol |
| Exact Mass | 654.19 |
| IUPAC Name | 1-benzyl-N-hydroxy-4-(4-phenylpiperazin-1-yl)sulfonylpiperidine-4-carboxamide;bis(2,2,2-trifluoroacetaldehyde) |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCN(c3ccccc3)CC2)CCN(Cc2ccccc2)CC1.O=CC(F)(F)F.O=CC(F)(F)F |
| InChI | InChI=1S/C23H30N4O4S.2C2HF3O/c28-22(24-29)23(11-13-25(14-12-23)19-20-7-3-1-4-8-20)32(30,31)27-17-15-26(16-18-27)21-9-5-2-6-10-21;2*3-2(4,5)1-6/h1-10,29H,11-19H2,(H,24,28);2*1H |
| InChIKey | FTZCQKLQQAUOCN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|