C25H32N2O6S — CID 20620686
4-[4-[4-(3,4-dihydro-2H-quinolin-1-yl)butoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620686) has the molecular formula C25H32N2O6S and a molecular weight of 488.61 g/mol. Its IUPAC name is 4-[4-[4-(3,4-dihydro-2H-quinolin-1-yl)butoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[4-(3,4-dihydro-2H-quinolin-1-yl)butoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620686 |
| Molecular Formula | C25H32N2O6S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-[4-[4-(3,4-dihydro-2H-quinolin-1-yl)butoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCCCN3CCCc4ccccc43)cc2)CCOCC1 |
| InChI | InChI=1S/C25H32N2O6S/c28-24(26-29)25(13-18-32-19-14-25)34(30,31)22-11-9-21(10-12-22)33-17-4-3-15-27-16-5-7-20-6-1-2-8-23(20)27/h1-2,6,8-12,29H,3-5,7,13-19H2,(H,26,28) |
| InChIKey | PFWQHEIRTTVHME-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|