C28H35F3N2O8S — CID 162305783
4-[4-[5-(3,4-dihydro-2H-quinolin-1-yl)pentoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 162305783) has the molecular formula C28H35F3N2O8S and a molecular weight of 616.66 g/mol. Its IUPAC name is 4-[4-[5-(3,4-dihydro-2H-quinolin-1-yl)pentoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-[5-(3,4-dihydro-2H-quinolin-1-yl)pentoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162305783 |
| Molecular Formula | C28H35F3N2O8S |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | 4-[4-[5-(3,4-dihydro-2H-quinolin-1-yl)pentoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(OCCCCCN3CCCc4ccccc43)cc2)CCOCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H34N2O6S.C2HF3O2/c29-25(27-30)26(14-19-33-20-15-26)35(31,32)23-12-10-22(11-13-23)34-18-5-1-4-16-28-17-6-8-21-7-2-3-9-24(21)28;3-2(4,5)1(6)7/h2-3,7,9-13,30H,1,4-6,8,14-20H2,(H,27,29);(H,6,7) |
| InChIKey | XTNGVQBHDBRENE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|