C18H17ClN2O3 — CID 84571309
3-[3-(4-chlorophenoxy)propyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 84571309) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is 3-[3-(4-chlorophenoxy)propyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(4-chlorophenoxy)propyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 84571309 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-[3-(4-chlorophenoxy)propyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)C(=O)N1CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2O3/c19-14-7-9-15(10-8-14)24-12-4-11-21-17(22)16(20-18(21)23)13-5-2-1-3-6-13/h1-3,5-10,16H,4,11-12H2,(H,20,23) |
| InChIKey | HVFSGEIGYSYENM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|