C21H18N2O3 — CID 84571228
3-(2-naphthalen-1-yloxyethyl)-5-phenylimidazolidine-2,4-dione (PubChem CID 84571228) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-(2-naphthalen-1-yloxyethyl)-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-(2-naphthalen-1-yloxyethyl)-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 84571228 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-(2-naphthalen-1-yloxyethyl)-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)C(=O)N1CCOc1cccc2ccccc12 |
| InChI | InChI=1S/C21H18N2O3/c24-20-19(16-8-2-1-3-9-16)22-21(25)23(20)13-14-26-18-12-6-10-15-7-4-5-11-17(15)18/h1-12,19H,13-14H2,(H,22,25) |
| InChIKey | PAMGIHNJEKUTJB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|