C24H28N2O7S3 — CID 20620637
4-[4-[3-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 20620637) has the molecular formula C24H28N2O7S3 and a molecular weight of 552.70 g/mol. Its IUPAC name is 4-[4-[3-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[3-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 20620637 |
| Molecular Formula | C24H28N2O7S3 |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 4-[4-[3-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]propoxy]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CCOc1ccc2nc(SCCCOc3ccc(S(=O)(=O)C4(C(=O)NO)CCOCC4)cc3)sc2c1 |
| InChI | InChI=1S/C24H28N2O7S3/c1-2-32-18-6-9-20-21(16-18)35-23(25-20)34-15-3-12-33-17-4-7-19(8-5-17)36(29,30)24(22(27)26-28)10-13-31-14-11-24/h4-9,16,28H,2-3,10-15H2,1H3,(H,26,27) |
| InChIKey | JXDAFTQUSZYLCI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|