C16H23Cl2N3O5S2 — CID 25028627
ethyl 2-[(4-chlorophenyl)sulfonylamino]-2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)acetate;hydrochloride (PubChem CID 25028627) has the molecular formula C16H23Cl2N3O5S2 and a molecular weight of 472.42 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)sulfonylamino]-2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)acetate;hydrochloride.
| Compound Name | ethyl 2-[(4-chlorophenyl)sulfonylamino]-2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)acetate;hydrochloride |
|---|---|
| PubChem CID | 25028627 |
| Molecular Formula | C16H23Cl2N3O5S2 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)sulfonylamino]-2-(1-methyl-4-nitrososulfanylpiperidin-4-yl)acetate;hydrochloride |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(Cl)cc1)C1(SN=O)CCN(C)CC1.Cl |
| InChI | InChI=1S/C16H22ClN3O5S2.ClH/c1-3-25-15(21)14(16(26-19-22)8-10-20(2)11-9-16)18-27(23,24)13-6-4-12(17)5-7-13;/h4-7,14,18H,3,8-11H2,1-2H3;1H |
| InChIKey | ZYUPETWPJKWQEL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|