C20H28BNO6S — CID 18686349
[4-[(4-but-2-ynoxyphenyl)sulfonylmethyl]-4-ethoxycarbonylpiperidin-1-yl]-methylborinic acid (PubChem CID 18686349) has the molecular formula C20H28BNO6S and a molecular weight of 421.32 g/mol. Its IUPAC name is [4-[(4-but-2-ynoxyphenyl)sulfonylmethyl]-4-ethoxycarbonylpiperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[(4-but-2-ynoxyphenyl)sulfonylmethyl]-4-ethoxycarbonylpiperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 18686349 |
| Molecular Formula | C20H28BNO6S |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [4-[(4-but-2-ynoxyphenyl)sulfonylmethyl]-4-ethoxycarbonylpiperidin-1-yl]-methylborinic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)CC2(C(=O)OCC)CCN(B(C)O)CC2)cc1 |
| InChI | InChI=1S/C20H28BNO6S/c1-4-6-15-28-17-7-9-18(10-8-17)29(25,26)16-20(19(23)27-5-2)11-13-22(14-12-20)21(3)24/h7-10,24H,5,11-16H2,1-3H3 |
| InChIKey | MDGRZKLXXPTFIM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|