C18H21NO5S — CID 23513865
4-[(4-but-2-ynoxyphenyl)sulfanylmethyl]piperidine-1,4-dicarboxylic acid (PubChem CID 23513865) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-[(4-but-2-ynoxyphenyl)sulfanylmethyl]piperidine-1,4-dicarboxylic acid.
| Compound Name | 4-[(4-but-2-ynoxyphenyl)sulfanylmethyl]piperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 23513865 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-[(4-but-2-ynoxyphenyl)sulfanylmethyl]piperidine-1,4-dicarboxylic acid |
| SMILES | CC#CCOc1ccc(SCC2(C(=O)O)CCN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-2-3-12-24-14-4-6-15(7-5-14)25-13-18(16(20)21)8-10-19(11-9-18)17(22)23/h4-7H,8-13H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | XXGKVOQKJXBWRW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|