C11H11BrO2S — CID 84814036
1-[(3-bromophenyl)sulfanylmethyl]cyclopropane-1-carboxylic acid (PubChem CID 84814036) has the molecular formula C11H11BrO2S and a molecular weight of 287.18 g/mol. Its IUPAC name is 1-[(3-bromophenyl)sulfanylmethyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(3-bromophenyl)sulfanylmethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 84814036 |
| Molecular Formula | C11H11BrO2S |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 1-[(3-bromophenyl)sulfanylmethyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(CSc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C11H11BrO2S/c12-8-2-1-3-9(6-8)15-7-11(4-5-11)10(13)14/h1-3,6H,4-5,7H2,(H,13,14) |
| InChIKey | RRZKQBNXZBOHMR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |