C13H17BrO2S — CID 65259979
5-(3-bromophenyl)sulfanyl-2,2-dimethylpentanoic acid (PubChem CID 65259979) has the molecular formula C13H17BrO2S and a molecular weight of 317.25 g/mol. Its IUPAC name is 5-(3-bromophenyl)sulfanyl-2,2-dimethylpentanoic acid.
| Compound Name | 5-(3-bromophenyl)sulfanyl-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 65259979 |
| Molecular Formula | C13H17BrO2S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 5-(3-bromophenyl)sulfanyl-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCSc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C13H17BrO2S/c1-13(2,12(15)16)7-4-8-17-11-6-3-5-10(14)9-11/h3,5-6,9H,4,7-8H2,1-2H3,(H,15,16) |
| InChIKey | HQCHJQOCHHTDAN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|