C13H16BrNO4S — CID 120531841
2-[[2-(3-bromophenyl)sulfanylacetyl]amino]-3-methoxy-2-methylpropanoic acid (PubChem CID 120531841) has the molecular formula C13H16BrNO4S and a molecular weight of 362.25 g/mol. Its IUPAC name is 2-[[2-(3-bromophenyl)sulfanylacetyl]amino]-3-methoxy-2-methylpropanoic acid.
| Compound Name | 2-[[2-(3-bromophenyl)sulfanylacetyl]amino]-3-methoxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120531841 |
| Molecular Formula | C13H16BrNO4S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 2-[[2-(3-bromophenyl)sulfanylacetyl]amino]-3-methoxy-2-methylpropanoic acid |
| SMILES | COCC(C)(NC(=O)CSc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C13H16BrNO4S/c1-13(8-19-2,12(17)18)15-11(16)7-20-10-5-3-4-9(14)6-10/h3-6H,7-8H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | MHIWGILCVFCAPF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |