C16H22BrNO5 — CID 120688623
2-[5-(4-bromophenoxy)pentanoylamino]-3-methoxy-2-methylpropanoic acid (PubChem CID 120688623) has the molecular formula C16H22BrNO5 and a molecular weight of 388.26 g/mol. Its IUPAC name is 2-[5-(4-bromophenoxy)pentanoylamino]-3-methoxy-2-methylpropanoic acid.
| Compound Name | 2-[5-(4-bromophenoxy)pentanoylamino]-3-methoxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120688623 |
| Molecular Formula | C16H22BrNO5 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-[5-(4-bromophenoxy)pentanoylamino]-3-methoxy-2-methylpropanoic acid |
| SMILES | COCC(C)(NC(=O)CCCCOc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C16H22BrNO5/c1-16(11-22-2,15(20)21)18-14(19)5-3-4-10-23-13-8-6-12(17)7-9-13/h6-9H,3-5,10-11H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | BDMZJYHHIVMZGB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|