C17H28BrClN2O2 — CID 119568938
N-[3-(aminomethyl)pentan-3-yl]-5-(4-bromophenoxy)pentanamide;hydrochloride (PubChem CID 119568938) has the molecular formula C17H28BrClN2O2 and a molecular weight of 407.78 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-5-(4-bromophenoxy)pentanamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-5-(4-bromophenoxy)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119568938 |
| Molecular Formula | C17H28BrClN2O2 |
| Molecular Weight | 407.78 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-5-(4-bromophenoxy)pentanamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)CCCCOc1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C17H27BrN2O2.ClH/c1-3-17(4-2,13-19)20-16(21)7-5-6-12-22-15-10-8-14(18)9-11-15;/h8-11H,3-7,12-13,19H2,1-2H3,(H,20,21);1H |
| InChIKey | QFEXCYIRFRHUCW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|