C16H26BrClN2O2S — CID 119571593
N-[3-(aminomethyl)pentan-3-yl]-4-(4-bromophenyl)sulfinylbutanamide;hydrochloride (PubChem CID 119571593) has the molecular formula C16H26BrClN2O2S and a molecular weight of 425.82 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-4-(4-bromophenyl)sulfinylbutanamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-4-(4-bromophenyl)sulfinylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119571593 |
| Molecular Formula | C16H26BrClN2O2S |
| Molecular Weight | 425.82 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-4-(4-bromophenyl)sulfinylbutanamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)CCCS(=O)c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C16H25BrN2O2S.ClH/c1-3-16(4-2,12-18)19-15(20)6-5-11-22(21)14-9-7-13(17)8-10-14;/h7-10H,3-6,11-12,18H2,1-2H3,(H,19,20);1H |
| InChIKey | RIPLADQGMRGYKD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.82 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |