About 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide
4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide (PubChem CID 95323115) has the molecular formula C14H20BrNO2S
and a molecular weight of 346.29 g/mol. Its IUPAC name is 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide.
Molecular Properties
| Compound Name | 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide |
| PubChem CID | 95323115 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCC[S@@](=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrNO2S/c1-3-16(4-2)14(17)6-5-11-19(18)13-9-7-12(15)8-10-13/h7-10H,3-6,11H2,1-2H3/t19-/m1/s1 |
| InChIKey | LHIQSMOYPFWDHF-LJQANCHMSA-N |
| XLogP | 3.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide?
The IUPAC name of 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide (CID 95323115) is 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide.
What is the SMILES notation for 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide?
The canonical SMILES for 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide is CCN(CC)C(=O)CCC[S@@](=O)c1ccc(Br)cc1.
What is the InChIKey of 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide?
The InChIKey is LHIQSMOYPFWDHF-LJQANCHMSA-N. The full InChI is InChI=1S/C14H20BrNO2S/c1-3-16(4-2)14(17)6-5-11-19(18)13-9-7-12(15)8-10-13/h7-10H,3-6,11H2,1-2H3/t19-/m1/s1.
What are the key properties of 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide?
4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide has a molecular weight of 346.29 g/mol, XLogP of 3.21, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(R)-(4-bromophenyl)sulfinyl]-N,N-diethylbutanamide is sourced from PubChem (CID 95323115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).