C14H18BrNO4S — CID 119170548
4-[4-(4-bromophenyl)sulfinylbutanoylamino]butanoic acid (PubChem CID 119170548) has the molecular formula C14H18BrNO4S and a molecular weight of 376.27 g/mol. Its IUPAC name is 4-[4-(4-bromophenyl)sulfinylbutanoylamino]butanoic acid.
| Compound Name | 4-[4-(4-bromophenyl)sulfinylbutanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119170548 |
| Molecular Formula | C14H18BrNO4S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 4-[4-(4-bromophenyl)sulfinylbutanoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CCCS(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H18BrNO4S/c15-11-5-7-12(8-6-11)21(20)10-2-3-13(17)16-9-1-4-14(18)19/h5-8H,1-4,9-10H2,(H,16,17)(H,18,19) |
| InChIKey | AOVNHEZSINERJZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|