C15H22BrClN2O2S — CID 119514095
4-(4-bromophenyl)sulfinyl-N-(pyrrolidin-2-ylmethyl)butanamide;hydrochloride (PubChem CID 119514095) has the molecular formula C15H22BrClN2O2S and a molecular weight of 409.78 g/mol. Its IUPAC name is 4-(4-bromophenyl)sulfinyl-N-(pyrrolidin-2-ylmethyl)butanamide;hydrochloride.
| Compound Name | 4-(4-bromophenyl)sulfinyl-N-(pyrrolidin-2-ylmethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119514095 |
| Molecular Formula | C15H22BrClN2O2S |
| Molecular Weight | 409.78 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 4-(4-bromophenyl)sulfinyl-N-(pyrrolidin-2-ylmethyl)butanamide;hydrochloride |
| SMILES | Cl.O=C(CCCS(=O)c1ccc(Br)cc1)NCC1CCCN1 |
| InChI | InChI=1S/C15H21BrN2O2S.ClH/c16-12-5-7-14(8-6-12)21(20)10-2-4-15(19)18-11-13-3-1-9-17-13;/h5-8,13,17H,1-4,9-11H2,(H,18,19);1H |
| InChIKey | LADAXDQFBHQQRK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.78 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |