About bromobenzene;1-bromo-3-butylsulfanylbenzene
bromobenzene;1-bromo-3-butylsulfanylbenzene (PubChem CID 158800951) has the molecular formula C16H18Br2S
and a molecular weight of 402.20 g/mol. Its IUPAC name is bromobenzene;1-bromo-3-butylsulfanylbenzene.
Molecular Properties
| Compound Name | bromobenzene;1-bromo-3-butylsulfanylbenzene |
| PubChem CID | 158800951 |
| Molecular Formula | C16H18Br2S |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | bromobenzene;1-bromo-3-butylsulfanylbenzene |
| SMILES | Brc1ccccc1.CCCCSc1cccc(Br)c1 |
| InChI | InChI=1S/C10H13BrS.C6H5Br/c1-2-3-7-12-10-6-4-5-9(11)8-10;7-6-4-2-1-3-5-6/h4-6,8H,2-3,7H2,1H3;1-5H |
| InChIKey | ITMAXKLWSDECBZ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bromobenzene;1-bromo-3-butylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;1-bromo-3-butylsulfanylbenzene?
The IUPAC name of bromobenzene;1-bromo-3-butylsulfanylbenzene (CID 158800951) is bromobenzene;1-bromo-3-butylsulfanylbenzene.
What is the SMILES notation for bromobenzene;1-bromo-3-butylsulfanylbenzene?
The canonical SMILES for bromobenzene;1-bromo-3-butylsulfanylbenzene is Brc1ccccc1.CCCCSc1cccc(Br)c1.
What is the InChIKey of bromobenzene;1-bromo-3-butylsulfanylbenzene?
The InChIKey is ITMAXKLWSDECBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrS.C6H5Br/c1-2-3-7-12-10-6-4-5-9(11)8-10;7-6-4-2-1-3-5-6/h4-6,8H,2-3,7H2,1H3;1-5H.
What are the key properties of bromobenzene;1-bromo-3-butylsulfanylbenzene?
bromobenzene;1-bromo-3-butylsulfanylbenzene has a molecular weight of 402.20 g/mol, XLogP of 6.79, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;1-bromo-3-butylsulfanylbenzene is sourced from PubChem (CID 158800951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).