About 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide
6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide (PubChem CID 106712830) has the molecular formula C14H21BrN2S
and a molecular weight of 329.31 g/mol. Its IUPAC name is 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide.
Molecular Properties
| Compound Name | 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide |
| PubChem CID | 106712830 |
| Molecular Formula | C14H21BrN2S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCSc1cccc(Br)c1 |
| InChI | InChI=1S/C14H21BrN2S/c1-14(2,13(16)17)8-3-4-9-18-12-7-5-6-11(15)10-12/h5-7,10H,3-4,8-9H2,1-2H3,(H3,16,17) |
| InChIKey | SKXWTOVMPUGFTO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide?
The IUPAC name of 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide (CID 106712830) is 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide.
What is the SMILES notation for 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide?
The canonical SMILES for 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide is [H]/N=C(\N)C(C)(C)CCCCSc1cccc(Br)c1.
What is the InChIKey of 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide?
The InChIKey is SKXWTOVMPUGFTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrN2S/c1-14(2,13(16)17)8-3-4-9-18-12-7-5-6-11(15)10-12/h5-7,10H,3-4,8-9H2,1-2H3,(H3,16,17).
What are the key properties of 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide?
6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide has a molecular weight of 329.31 g/mol, XLogP of 4.67, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-bromophenyl)sulfanyl-2,2-dimethylhexanimidamide is sourced from PubChem (CID 106712830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).