C15H23ClN2S — CID 106712864
6-[(2-chlorophenyl)methylsulfanyl]-2,2-dimethylhexanimidamide (PubChem CID 106712864) has the molecular formula C15H23ClN2S and a molecular weight of 298.88 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methylsulfanyl]-2,2-dimethylhexanimidamide.
| Compound Name | 6-[(2-chlorophenyl)methylsulfanyl]-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106712864 |
| Molecular Formula | C15H23ClN2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 6-[(2-chlorophenyl)methylsulfanyl]-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCSCc1ccccc1Cl |
| InChI | InChI=1S/C15H23ClN2S/c1-15(2,14(17)18)9-5-6-10-19-11-12-7-3-4-8-13(12)16/h3-4,7-8H,5-6,9-11H2,1-2H3,(H3,17,18) |
| InChIKey | WQEXYAWPLZHJLB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|