C8H12ClNO4 — CID 123497269
4-(chloromethyl)piperidine-1,4-dicarboxylic acid (PubChem CID 123497269) has the molecular formula C8H12ClNO4 and a molecular weight of 221.64 g/mol. Its IUPAC name is 4-(chloromethyl)piperidine-1,4-dicarboxylic acid.
| Compound Name | 4-(chloromethyl)piperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 123497269 |
| Molecular Formula | C8H12ClNO4 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 4-(chloromethyl)piperidine-1,4-dicarboxylic acid |
| SMILES | O=C(O)N1CCC(CCl)(C(=O)O)CC1 |
| InChI | InChI=1S/C8H12ClNO4/c9-5-8(6(11)12)1-3-10(4-2-8)7(13)14/h1-5H2,(H,11,12)(H,13,14) |
| InChIKey | BXATXEOIPRSWCR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|