4-(chloromethyl)piperidine-1,4-dicarboxylic acid

C8H12ClNO4 — CID 123497269

IUPAC4-(chloromethyl)piperidine-1,4-dicarboxylic acid
SMILESO=C(O)N1CCC(CCl)(C(=O)O)CC1
InChIInChI=1S/C8H12ClNO4/c9-5-8(6(11)12)1-3-10(4-2-8)7(13)14/h1-5H2,(H,11,12)(H,13,14)
InChIKeyBXATXEOIPRSWCR-UHFFFAOYSA-N
MW221.64 g/mol
LogP1.07
Rot. Bonds2

About 4-(chloromethyl)piperidine-1,4-dicarboxylic acid

4-(chloromethyl)piperidine-1,4-dicarboxylic acid (PubChem CID 123497269) has the molecular formula C8H12ClNO4 and a molecular weight of 221.64 g/mol. Its IUPAC name is 4-(chloromethyl)piperidine-1,4-dicarboxylic acid.

Molecular Properties

Compound Name4-(chloromethyl)piperidine-1,4-dicarboxylic acid
PubChem CID123497269
Molecular FormulaC8H12ClNO4
Molecular Weight221.64 g/mol
Exact Mass221.05
IUPAC Name4-(chloromethyl)piperidine-1,4-dicarboxylic acid
SMILESO=C(O)N1CCC(CCl)(C(=O)O)CC1
InChIInChI=1S/C8H12ClNO4/c9-5-8(6(11)12)1-3-10(4-2-8)7(13)14/h1-5H2,(H,11,12)(H,13,14)
InChIKeyBXATXEOIPRSWCR-UHFFFAOYSA-N
XLogP1.07
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.64
LogP ≤ 51.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 4-(chloromethyl)piperidine-1,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(chloromethyl)piperidine-1,4-dicarboxylic acid?
The IUPAC name of 4-(chloromethyl)piperidine-1,4-dicarboxylic acid (CID 123497269) is 4-(chloromethyl)piperidine-1,4-dicarboxylic acid.
What is the SMILES notation for 4-(chloromethyl)piperidine-1,4-dicarboxylic acid?
The canonical SMILES for 4-(chloromethyl)piperidine-1,4-dicarboxylic acid is O=C(O)N1CCC(CCl)(C(=O)O)CC1.
What is the InChIKey of 4-(chloromethyl)piperidine-1,4-dicarboxylic acid?
The InChIKey is BXATXEOIPRSWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClNO4/c9-5-8(6(11)12)1-3-10(4-2-8)7(13)14/h1-5H2,(H,11,12)(H,13,14).
What are the key properties of 4-(chloromethyl)piperidine-1,4-dicarboxylic acid?
4-(chloromethyl)piperidine-1,4-dicarboxylic acid has a molecular weight of 221.64 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)piperidine-1,4-dicarboxylic acid is sourced from PubChem (CID 123497269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).