C15H18N2O5 — CID 67419609
4-[(4-carbamoylphenyl)methyl]piperidine-1,4-dicarboxylic acid (PubChem CID 67419609) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-[(4-carbamoylphenyl)methyl]piperidine-1,4-dicarboxylic acid.
| Compound Name | 4-[(4-carbamoylphenyl)methyl]piperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 67419609 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-[(4-carbamoylphenyl)methyl]piperidine-1,4-dicarboxylic acid |
| SMILES | NC(=O)c1ccc(CC2(C(=O)O)CCN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C15H18N2O5/c16-12(18)11-3-1-10(2-4-11)9-15(13(19)20)5-7-17(8-6-15)14(21)22/h1-4H,5-9H2,(H2,16,18)(H,19,20)(H,21,22) |
| InChIKey | JPOGVOPRHWUBOI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |