About 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid
4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid (PubChem CID 91032989) has the molecular formula C10H18ClN3O4
and a molecular weight of 279.72 g/mol. Its IUPAC name is 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid |
| PubChem CID | 91032989 |
| Molecular Formula | C10H18ClN3O4 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid |
| SMILES | NC(=NO)C1(COCCCl)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C10H18ClN3O4/c11-3-6-18-7-10(8(12)13-17)1-4-14(5-2-10)9(15)16/h17H,1-7H2,(H2,12,13)(H,15,16) |
| InChIKey | WCMUCEINAWKQMI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid?
The IUPAC name of 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid (CID 91032989) is 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid.
What is the SMILES notation for 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid?
The canonical SMILES for 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid is NC(=NO)C1(COCCCl)CCN(C(=O)O)CC1.
What is the InChIKey of 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid?
The InChIKey is WCMUCEINAWKQMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClN3O4/c11-3-6-18-7-10(8(12)13-17)1-4-14(5-2-10)9(15)16/h17H,1-7H2,(H2,12,13)(H,15,16).
What are the key properties of 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid?
4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid has a molecular weight of 279.72 g/mol, XLogP of 0.75, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethoxymethyl)-4-(N'-hydroxycarbamimidoyl)piperidine-1-carboxylic acid is sourced from PubChem (CID 91032989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).