C19H22BrNO5S — CID 23506748
5-bromo-2-[(4-butoxyphenyl)sulfonyl-methylamino]-3-methylbenzoic acid (PubChem CID 23506748) has the molecular formula C19H22BrNO5S and a molecular weight of 456.36 g/mol. Its IUPAC name is 5-bromo-2-[(4-butoxyphenyl)sulfonyl-methylamino]-3-methylbenzoic acid.
| Compound Name | 5-bromo-2-[(4-butoxyphenyl)sulfonyl-methylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 23506748 |
| Molecular Formula | C19H22BrNO5S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 5-bromo-2-[(4-butoxyphenyl)sulfonyl-methylamino]-3-methylbenzoic acid |
| SMILES | CCCCOc1ccc(S(=O)(=O)N(C)c2c(C)cc(Br)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C19H22BrNO5S/c1-4-5-10-26-15-6-8-16(9-7-15)27(24,25)21(3)18-13(2)11-14(20)12-17(18)19(22)23/h6-9,11-12H,4-5,10H2,1-3H3,(H,22,23) |
| InChIKey | DKCYPRUEJQLSRA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|