C18H20BrN3O7S — CID 21310813
5-bromo-N-hydroxy-3-[3-(hydroxyamino)-3-oxopropyl]-2-[(4-methoxyphenyl)sulfonyl-methylamino]benzamide (PubChem CID 21310813) has the molecular formula C18H20BrN3O7S and a molecular weight of 502.34 g/mol. Its IUPAC name is 5-bromo-N-hydroxy-3-[3-(hydroxyamino)-3-oxopropyl]-2-[(4-methoxyphenyl)sulfonyl-methylamino]benzamide.
| Compound Name | 5-bromo-N-hydroxy-3-[3-(hydroxyamino)-3-oxopropyl]-2-[(4-methoxyphenyl)sulfonyl-methylamino]benzamide |
|---|---|
| PubChem CID | 21310813 |
| Molecular Formula | C18H20BrN3O7S |
| Molecular Weight | 502.34 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | 5-bromo-N-hydroxy-3-[3-(hydroxyamino)-3-oxopropyl]-2-[(4-methoxyphenyl)sulfonyl-methylamino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2c(CCC(=O)NO)cc(Br)cc2C(=O)NO)cc1 |
| InChI | InChI=1S/C18H20BrN3O7S/c1-22(30(27,28)14-6-4-13(29-2)5-7-14)17-11(3-8-16(23)20-25)9-12(19)10-15(17)18(24)21-26/h4-7,9-10,25-26H,3,8H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | FXWLEALDNQOYAO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|