About N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine
N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine (PubChem CID 142387605) has the molecular formula C20H36N2O2
and a molecular weight of 336.52 g/mol. Its IUPAC name is N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine.
Molecular Properties
| Compound Name | N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine |
| PubChem CID | 142387605 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine |
| SMILES | CCCC(C)(C)c1ccc(OCCN2CCOCC2)cc1.CNC |
| InChI | InChI=1S/C18H29NO2.C2H7N/c1-4-9-18(2,3)16-5-7-17(8-6-16)21-15-12-19-10-13-20-14-11-19;1-3-2/h5-8H,4,9-15H2,1-3H3;3H,1-2H3 |
| InChIKey | VDSJBJJUYQJYFF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine?
The IUPAC name of N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine (CID 142387605) is N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine.
What is the SMILES notation for N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine?
The canonical SMILES for N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine is CCCC(C)(C)c1ccc(OCCN2CCOCC2)cc1.CNC.
What is the InChIKey of N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine?
The InChIKey is VDSJBJJUYQJYFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2.C2H7N/c1-4-9-18(2,3)16-5-7-17(8-6-16)21-15-12-19-10-13-20-14-11-19;1-3-2/h5-8H,4,9-15H2,1-3H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine?
N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine has a molecular weight of 336.52 g/mol, XLogP of 3.31, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;4-[2-[4-(2-methylpentan-2-yl)phenoxy]ethyl]morpholine is sourced from PubChem (CID 142387605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).