C27H33NO6S — CID 22634083
2-(4-but-2-ynoxyphenyl)sulfonyl-4-[4-(2-piperidin-1-ylethoxy)phenyl]butanoic acid (PubChem CID 22634083) has the molecular formula C27H33NO6S and a molecular weight of 499.63 g/mol. Its IUPAC name is 2-(4-but-2-ynoxyphenyl)sulfonyl-4-[4-(2-piperidin-1-ylethoxy)phenyl]butanoic acid.
| Compound Name | 2-(4-but-2-ynoxyphenyl)sulfonyl-4-[4-(2-piperidin-1-ylethoxy)phenyl]butanoic acid |
|---|---|
| PubChem CID | 22634083 |
| Molecular Formula | C27H33NO6S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 2-(4-but-2-ynoxyphenyl)sulfonyl-4-[4-(2-piperidin-1-ylethoxy)phenyl]butanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C(CCc2ccc(OCCN3CCCCC3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H33NO6S/c1-2-3-20-33-24-12-14-25(15-13-24)35(31,32)26(27(29)30)16-9-22-7-10-23(11-8-22)34-21-19-28-17-5-4-6-18-28/h7-8,10-15,26H,4-6,9,16-21H2,1H3,(H,29,30) |
| InChIKey | VSBZLJNKZZTWHM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|