C29H34N2O6S — CID 58896323
N-(4-acetylphenyl)-N-[(4-methoxyphenyl)methyl]-4-(3-morpholin-4-ylpropoxy)benzenesulfonamide (PubChem CID 58896323) has the molecular formula C29H34N2O6S and a molecular weight of 538.67 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N-[(4-methoxyphenyl)methyl]-4-(3-morpholin-4-ylpropoxy)benzenesulfonamide.
| Compound Name | N-(4-acetylphenyl)-N-[(4-methoxyphenyl)methyl]-4-(3-morpholin-4-ylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 58896323 |
| Molecular Formula | C29H34N2O6S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | N-(4-acetylphenyl)-N-[(4-methoxyphenyl)methyl]-4-(3-morpholin-4-ylpropoxy)benzenesulfonamide |
| SMILES | COc1ccc(CN(c2ccc(C(C)=O)cc2)S(=O)(=O)c2ccc(OCCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H34N2O6S/c1-23(32)25-6-8-26(9-7-25)31(22-24-4-10-27(35-2)11-5-24)38(33,34)29-14-12-28(13-15-29)37-19-3-16-30-17-20-36-21-18-30/h4-15H,3,16-22H2,1-2H3 |
| InChIKey | BVGFTSAFDRSWDH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|