C22H29N3O5S — CID 92649125
2-[4-[benzenesulfonyl(methyl)amino]phenoxy]-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 92649125) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[4-[benzenesulfonyl(methyl)amino]phenoxy]-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-[4-[benzenesulfonyl(methyl)amino]phenoxy]-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 92649125 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-[4-[benzenesulfonyl(methyl)amino]phenoxy]-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | CN(c1ccc(OCC(=O)NCCCN2CCOCC2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O5S/c1-24(31(27,28)21-6-3-2-4-7-21)19-8-10-20(11-9-19)30-18-22(26)23-12-5-13-25-14-16-29-17-15-25/h2-4,6-11H,5,12-18H2,1H3,(H,23,26) |
| InChIKey | HUFJIBMPRGFPJB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|