C21H27F3N2O2S — CID 22279334
N-methyl-N-prop-2-enyl-5-[1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]pent-4-yn-1-amine (PubChem CID 22279334) has the molecular formula C21H27F3N2O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is N-methyl-N-prop-2-enyl-5-[1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]pent-4-yn-1-amine.
| Compound Name | N-methyl-N-prop-2-enyl-5-[1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]pent-4-yn-1-amine |
|---|---|
| PubChem CID | 22279334 |
| Molecular Formula | C21H27F3N2O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-methyl-N-prop-2-enyl-5-[1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]pent-4-yn-1-amine |
| SMILES | C=CCN(C)CCCC#CC1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H27F3N2O2S/c1-3-14-25(2)15-6-4-5-7-18-12-16-26(17-13-18)29(27,28)20-10-8-19(9-11-20)21(22,23)24/h3,8-11,18H,1,4,6,12-17H2,2H3 |
| InChIKey | PJAMYMTXGIOCFV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|