C19H24N2O5S — CID 120552645
4-[4-[cyclopropyl(prop-2-enyl)carbamoyl]piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 120552645) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-[4-[cyclopropyl(prop-2-enyl)carbamoyl]piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-[4-[cyclopropyl(prop-2-enyl)carbamoyl]piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 120552645 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 4-[4-[cyclopropyl(prop-2-enyl)carbamoyl]piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | C=CCN(C(=O)C1CCN(S(=O)(=O)c2ccc(C(=O)O)cc2)CC1)C1CC1 |
| InChI | InChI=1S/C19H24N2O5S/c1-2-11-21(16-5-6-16)18(22)14-9-12-20(13-10-14)27(25,26)17-7-3-15(4-8-17)19(23)24/h2-4,7-8,14,16H,1,5-6,9-13H2,(H,23,24) |
| InChIKey | BMZZBHJMFVWSCQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|