C20H22ClFN2O3S2 — CID 55360515
N-[(5-chlorothiophen-2-yl)methyl]-1-(4-fluorophenyl)sulfonyl-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 55360515) has the molecular formula C20H22ClFN2O3S2 and a molecular weight of 456.99 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-1-(4-fluorophenyl)sulfonyl-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-1-(4-fluorophenyl)sulfonyl-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55360515 |
| Molecular Formula | C20H22ClFN2O3S2 |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-1-(4-fluorophenyl)sulfonyl-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22ClFN2O3S2/c1-2-11-23(14-17-5-8-19(21)28-17)20(25)15-9-12-24(13-10-15)29(26,27)18-6-3-16(22)4-7-18/h2-8,15H,1,9-14H2 |
| InChIKey | NDFBWPDHVKNREK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|