C18H21BrN2O3S3 — CID 55372586
1-(5-bromothiophen-2-yl)sulfonyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 55372586) has the molecular formula C18H21BrN2O3S3 and a molecular weight of 489.48 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55372586 |
| Molecular Formula | C18H21BrN2O3S3 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)C1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C18H21BrN2O3S3/c1-2-9-20(13-15-4-3-12-25-15)18(22)14-7-10-21(11-8-14)27(23,24)17-6-5-16(19)26-17/h2-6,12,14H,1,7-11,13H2 |
| InChIKey | BZWJNIJKQRCWLQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|