C17H25ClN2O3S — CID 119907626
1-[1-oxo-1-[prop-2-enyl(thiophen-2-ylmethyl)amino]propan-2-yl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 119907626) has the molecular formula C17H25ClN2O3S and a molecular weight of 372.92 g/mol. Its IUPAC name is 1-[1-oxo-1-[prop-2-enyl(thiophen-2-ylmethyl)amino]propan-2-yl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[1-oxo-1-[prop-2-enyl(thiophen-2-ylmethyl)amino]propan-2-yl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119907626 |
| Molecular Formula | C17H25ClN2O3S |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-[1-oxo-1-[prop-2-enyl(thiophen-2-ylmethyl)amino]propan-2-yl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | C=CCN(Cc1cccs1)C(=O)C(C)N1CCC(C(=O)O)CC1.Cl |
| InChI | InChI=1S/C17H24N2O3S.ClH/c1-3-8-19(12-15-5-4-11-23-15)16(20)13(2)18-9-6-14(7-10-18)17(21)22;/h3-5,11,13-14H,1,6-10,12H2,2H3,(H,21,22);1H |
| InChIKey | JPKLXXAGTJCBPR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|