C21H29N5OS — CID 86868228
2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 86868228) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 86868228 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)C(C)N1CCN(c2cc(C)nc(C)n2)CC1 |
| InChI | InChI=1S/C21H29N5OS/c1-5-8-26(15-19-7-6-13-28-19)21(27)17(3)24-9-11-25(12-10-24)20-14-16(2)22-18(4)23-20/h5-7,13-14,17H,1,8-12,15H2,2-4H3 |
| InChIKey | IDTFFUCNPZESQB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|