C13H22N6O — CID 77012254
2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-N'-hydroxypropanimidamide (PubChem CID 77012254) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-N'-hydroxypropanimidamide.
| Compound Name | 2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77012254 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-[4-(2,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-N'-hydroxypropanimidamide |
| SMILES | Cc1cc(N2CCN(C(C)C(N)=NO)CC2)nc(C)n1 |
| InChI | InChI=1S/C13H22N6O/c1-9-8-12(16-11(3)15-9)19-6-4-18(5-7-19)10(2)13(14)17-20/h8,10,20H,4-7H2,1-3H3,(H2,14,17) |
| InChIKey | RRFJLXWTRDYPBG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|