C8H13N5 — CID 155533291
4-(3-aminoazetidin-1-yl)-6-methylpyrimidin-2-amine (PubChem CID 155533291) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 4-(3-aminoazetidin-1-yl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(3-aminoazetidin-1-yl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 155533291 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 4-(3-aminoazetidin-1-yl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CC(N)C2)nc(N)n1 |
| InChI | InChI=1S/C8H13N5/c1-5-2-7(12-8(10)11-5)13-3-6(9)4-13/h2,6H,3-4,9H2,1H3,(H2,10,11,12) |
| InChIKey | NNRWOZRAHOUFDJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |