C10H17N5 — CID 59777245
4-(3-aminoazetidin-1-yl)-6-propan-2-ylpyrimidin-2-amine (PubChem CID 59777245) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-(3-aminoazetidin-1-yl)-6-propan-2-ylpyrimidin-2-amine.
| Compound Name | 4-(3-aminoazetidin-1-yl)-6-propan-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 59777245 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 4-(3-aminoazetidin-1-yl)-6-propan-2-ylpyrimidin-2-amine |
| SMILES | CC(C)c1cc(N2CC(N)C2)nc(N)n1 |
| InChI | InChI=1S/C10H17N5/c1-6(2)8-3-9(14-10(12)13-8)15-4-7(11)5-15/h3,6-7H,4-5,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | AKMCDNOSDOZEAA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |