C12H19N5 — CID 24797956
4-(3-aminoazetidin-1-yl)-6-cyclopentylpyrimidin-2-amine (PubChem CID 24797956) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 4-(3-aminoazetidin-1-yl)-6-cyclopentylpyrimidin-2-amine.
| Compound Name | 4-(3-aminoazetidin-1-yl)-6-cyclopentylpyrimidin-2-amine |
|---|---|
| PubChem CID | 24797956 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-(3-aminoazetidin-1-yl)-6-cyclopentylpyrimidin-2-amine |
| SMILES | Nc1nc(C2CCCC2)cc(N2CC(N)C2)n1 |
| InChI | InChI=1S/C12H19N5/c13-9-6-17(7-9)11-5-10(15-12(14)16-11)8-3-1-2-4-8/h5,8-9H,1-4,6-7,13H2,(H2,14,15,16) |
| InChIKey | DMQGRIJTXNTELD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |