C9H17Cl2N5 — CID 155533425
4-methyl-6-[3-(methylamino)azetidin-1-yl]pyrimidin-2-amine;dihydrochloride (PubChem CID 155533425) has the molecular formula C9H17Cl2N5 and a molecular weight of 266.18 g/mol. Its IUPAC name is 4-methyl-6-[3-(methylamino)azetidin-1-yl]pyrimidin-2-amine;dihydrochloride.
| Compound Name | 4-methyl-6-[3-(methylamino)azetidin-1-yl]pyrimidin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 155533425 |
| Molecular Formula | C9H17Cl2N5 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-methyl-6-[3-(methylamino)azetidin-1-yl]pyrimidin-2-amine;dihydrochloride |
| SMILES | CNC1CN(c2cc(C)nc(N)n2)C1.Cl.Cl |
| InChI | InChI=1S/C9H15N5.2ClH/c1-6-3-8(13-9(10)12-6)14-4-7(5-14)11-2;;/h3,7,11H,4-5H2,1-2H3,(H2,10,12,13);2*1H |
| InChIKey | CCMYRDFTJFOPOX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |