C18H21FN2OS — CID 78842146
2-(3-fluoro-4-methylanilino)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 78842146) has the molecular formula C18H21FN2OS and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylanilino)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 2-(3-fluoro-4-methylanilino)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 78842146 |
| Molecular Formula | C18H21FN2OS |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-(3-fluoro-4-methylanilino)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)C(C)Nc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C18H21FN2OS/c1-4-9-21(12-16-6-5-10-23-16)18(22)14(3)20-15-8-7-13(2)17(19)11-15/h4-8,10-11,14,20H,1,9,12H2,2-3H3 |
| InChIKey | PSPFRSBXZUOTDC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|