C16H19BrN2O3S3 — CID 24654701
1-(5-bromothiophen-2-yl)sulfonyl-N-(2-thiophen-2-ylethyl)piperidine-3-carboxamide (PubChem CID 24654701) has the molecular formula C16H19BrN2O3S3 and a molecular weight of 463.44 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-thiophen-2-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-thiophen-2-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24654701 |
| Molecular Formula | C16H19BrN2O3S3 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(2-thiophen-2-ylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCc1cccs1)C1CCCN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C16H19BrN2O3S3/c17-14-5-6-15(24-14)25(21,22)19-9-1-3-12(11-19)16(20)18-8-7-13-4-2-10-23-13/h2,4-6,10,12H,1,3,7-9,11H2,(H,18,20) |
| InChIKey | NEYRCYQYAINUGR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |