C17H21N3O5S2 — CID 55548927
N-[2-(furan-2-carbonylamino)ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 55548927) has the molecular formula C17H21N3O5S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[2-(furan-2-carbonylamino)ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-(furan-2-carbonylamino)ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55548927 |
| Molecular Formula | C17H21N3O5S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N-[2-(furan-2-carbonylamino)ethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCCN(S(=O)(=O)c2cccs2)C1)c1ccco1 |
| InChI | InChI=1S/C17H21N3O5S2/c21-16(18-7-8-19-17(22)14-5-2-10-25-14)13-4-1-9-20(12-13)27(23,24)15-6-3-11-26-15/h2-3,5-6,10-11,13H,1,4,7-9,12H2,(H,18,21)(H,19,22) |
| InChIKey | OHLFTTQUXRAXQP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|