C21H24ClN3O2S — CID 9087397
(3S)-3-N-[(5-chlorothiophen-2-yl)methyl]-1-N-phenyl-3-N-prop-2-enylpiperidine-1,3-dicarboxamide (PubChem CID 9087397) has the molecular formula C21H24ClN3O2S and a molecular weight of 417.96 g/mol. Its IUPAC name is (3S)-3-N-[(5-chlorothiophen-2-yl)methyl]-1-N-phenyl-3-N-prop-2-enylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[(5-chlorothiophen-2-yl)methyl]-1-N-phenyl-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 9087397 |
| Molecular Formula | C21H24ClN3O2S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (3S)-3-N-[(5-chlorothiophen-2-yl)methyl]-1-N-phenyl-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)[C@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C21H24ClN3O2S/c1-2-12-24(15-18-10-11-19(22)28-18)20(26)16-7-6-13-25(14-16)21(27)23-17-8-4-3-5-9-17/h2-5,8-11,16H,1,6-7,12-15H2,(H,23,27)/t16-/m0/s1 |
| InChIKey | KNUTVWAHALUHSF-INIZCTEOSA-N |
| XLogP | 4.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|