C24H23N3O6S — CID 66907928
N-benzyl-N-[(2,5-dioxoimidazolidin-4-yl)methyl]-4-(4-methoxyphenoxy)benzenesulfonamide (PubChem CID 66907928) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is N-benzyl-N-[(2,5-dioxoimidazolidin-4-yl)methyl]-4-(4-methoxyphenoxy)benzenesulfonamide.
| Compound Name | N-benzyl-N-[(2,5-dioxoimidazolidin-4-yl)methyl]-4-(4-methoxyphenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 66907928 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-benzyl-N-[(2,5-dioxoimidazolidin-4-yl)methyl]-4-(4-methoxyphenoxy)benzenesulfonamide |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)N(Cc3ccccc3)CC3NC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O6S/c1-32-18-7-9-19(10-8-18)33-20-11-13-21(14-12-20)34(30,31)27(15-17-5-3-2-4-6-17)16-22-23(28)26-24(29)25-22/h2-14,22H,15-16H2,1H3,(H2,25,26,28,29) |
| InChIKey | BSSADWIFCVXYLU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|